About (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine
(6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine (PubChem CID 1474536) has the molecular formula C18H13Cl2N3
and a molecular weight of 342.23 g/mol. Its IUPAC name is (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine.
Molecular Properties
| Compound Name | (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine |
| PubChem CID | 1474536 |
| Molecular Formula | C18H13Cl2N3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine |
| SMILES | Nc1ncc2c(n1)-c1ccccc1[C@H](c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C18H13Cl2N3/c19-15-6-5-10(8-16(15)20)14-7-11-9-22-18(21)23-17(11)13-4-2-1-3-12(13)14/h1-6,8-9,14H,7H2,(H2,21,22,23)/t14-/m0/s1 |
| InChIKey | SQMXGNUOHXNMKE-AWEZNQCLSA-N |
| XLogP | 4.72 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine?
The IUPAC name of (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine (CID 1474536) is (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine.
What is the SMILES notation for (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine?
The canonical SMILES for (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine is Nc1ncc2c(n1)-c1ccccc1[C@H](c1ccc(Cl)c(Cl)c1)C2.
What is the InChIKey of (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine?
The InChIKey is SQMXGNUOHXNMKE-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H13Cl2N3/c19-15-6-5-10(8-16(15)20)14-7-11-9-22-18(21)23-17(11)13-4-2-1-3-12(13)14/h1-6,8-9,14H,7H2,(H2,21,22,23)/t14-/m0/s1.
What are the key properties of (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine?
(6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine has a molecular weight of 342.23 g/mol, XLogP of 4.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[h]quinazolin-2-amine is sourced from PubChem (CID 1474536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).