C33H52N4O6S2 — CID 147455829
1-[6,8-bis(sulfanyl)octanoylamino]-N-[(2S)-1-[[(2S)-4-(ethylamino)-1-(4-methoxyphenyl)-3,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]cyclohexane-1-carboxamide (PubChem CID 147455829) has the molecular formula C33H52N4O6S2 and a molecular weight of 664.94 g/mol. Its IUPAC name is 1-[6,8-bis(sulfanyl)octanoylamino]-N-[(2S)-1-[[(2S)-4-(ethylamino)-1-(4-methoxyphenyl)-3,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 1-[6,8-bis(sulfanyl)octanoylamino]-N-[(2S)-1-[[(2S)-4-(ethylamino)-1-(4-methoxyphenyl)-3,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 147455829 |
| Molecular Formula | C33H52N4O6S2 |
| Molecular Weight | 664.94 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | 1-[6,8-bis(sulfanyl)octanoylamino]-N-[(2S)-1-[[(2S)-4-(ethylamino)-1-(4-methoxyphenyl)-3,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]cyclohexane-1-carboxamide |
| SMILES | CCNC(=O)C(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)[C@@H](NC(=O)C1(NC(=O)CCCCC(S)CCS)CCCCC1)C(C)C |
| InChI | InChI=1S/C33H52N4O6S2/c1-5-34-31(41)29(39)26(21-23-13-15-24(43-4)16-14-23)35-30(40)28(22(2)3)36-32(42)33(18-9-6-10-19-33)37-27(38)12-8-7-11-25(45)17-20-44/h13-16,22,25-26,28,44-45H,5-12,17-21H2,1-4H3,(H,34,41)(H,35,40)(H,36,42)(H,37,38)/t25?,26-,28-/m0/s1 |
| InChIKey | DYYSYVSGZZJWRR-KKGVWULHSA-N |
| XLogP | 3.57 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.94 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|