C8H10F6O — CID 147456797
5,5,5-trifluoro-2-methyl-4-(2,2,2-trifluoroethoxy)pent-1-ene (PubChem CID 147456797) has the molecular formula C8H10F6O and a molecular weight of 236.15 g/mol. Its IUPAC name is 5,5,5-trifluoro-2-methyl-4-(2,2,2-trifluoroethoxy)pent-1-ene.
| Compound Name | 5,5,5-trifluoro-2-methyl-4-(2,2,2-trifluoroethoxy)pent-1-ene |
|---|---|
| PubChem CID | 147456797 |
| Molecular Formula | C8H10F6O |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 5,5,5-trifluoro-2-methyl-4-(2,2,2-trifluoroethoxy)pent-1-ene |
| SMILES | C=C(C)CC(OCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F6O/c1-5(2)3-6(8(12,13)14)15-4-7(9,10)11/h6H,1,3-4H2,2H3 |
| InChIKey | DZDIYSNTPZDPGQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|