C36H45F3N2O4 — CID 14745798
1-O-[4-(5-decylpyrimidin-2-yl)phenyl] 4-O-(1,1,1-trifluorooctan-2-yl) benzene-1,4-dicarboxylate (PubChem CID 14745798) has the molecular formula C36H45F3N2O4 and a molecular weight of 626.76 g/mol. Its IUPAC name is 1-O-[4-(5-decylpyrimidin-2-yl)phenyl] 4-O-(1,1,1-trifluorooctan-2-yl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[4-(5-decylpyrimidin-2-yl)phenyl] 4-O-(1,1,1-trifluorooctan-2-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 14745798 |
| Molecular Formula | C36H45F3N2O4 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | 1-O-[4-(5-decylpyrimidin-2-yl)phenyl] 4-O-(1,1,1-trifluorooctan-2-yl) benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(OC(=O)c3ccc(C(=O)OC(CCCCCC)C(F)(F)F)cc3)cc2)nc1 |
| InChI | InChI=1S/C36H45F3N2O4/c1-3-5-7-9-10-11-12-13-15-27-25-40-33(41-26-27)28-21-23-31(24-22-28)44-34(42)29-17-19-30(20-18-29)35(43)45-32(36(37,38)39)16-14-8-6-4-2/h17-26,32H,3-16H2,1-2H3 |
| InChIKey | DFFGEFLSOLYGOD-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|