C36H47F3N2O3 — CID 14745803
1,1,1-trifluorooctan-2-yl 4-[[4-(5-decylpyrimidin-2-yl)phenoxy]methyl]benzoate (PubChem CID 14745803) has the molecular formula C36H47F3N2O3 and a molecular weight of 612.78 g/mol. Its IUPAC name is 1,1,1-trifluorooctan-2-yl 4-[[4-(5-decylpyrimidin-2-yl)phenoxy]methyl]benzoate.
| Compound Name | 1,1,1-trifluorooctan-2-yl 4-[[4-(5-decylpyrimidin-2-yl)phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 14745803 |
| Molecular Formula | C36H47F3N2O3 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | 1,1,1-trifluorooctan-2-yl 4-[[4-(5-decylpyrimidin-2-yl)phenoxy]methyl]benzoate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(OCc3ccc(C(=O)OC(CCCCCC)C(F)(F)F)cc3)cc2)nc1 |
| InChI | InChI=1S/C36H47F3N2O3/c1-3-5-7-9-10-11-12-13-15-29-25-40-34(41-26-29)30-21-23-32(24-22-30)43-27-28-17-19-31(20-18-28)35(42)44-33(36(37,38)39)16-14-8-6-4-2/h17-26,33H,3-16,27H2,1-2H3 |
| InChIKey | OELTUZIEPWTUMT-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|