About 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride
1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride (PubChem CID 147458194) has the molecular formula C7H9ClO5S
and a molecular weight of 240.66 g/mol. Its IUPAC name is 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride |
| PubChem CID | 147458194 |
| Molecular Formula | C7H9ClO5S |
| Molecular Weight | 240.66 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride |
| SMILES | O=C1OC[C@@H](CC2(S(=O)(=O)Cl)CC2)O1 |
| InChI | InChI=1S/C7H9ClO5S/c8-14(10,11)7(1-2-7)3-5-4-12-6(9)13-5/h5H,1-4H2/t5-/m1/s1 |
| InChIKey | DZKIEPNRXHDSBC-RXMQYKEDSA-N |
| XLogP | 1.01 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.66 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride?
The IUPAC name of 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride (CID 147458194) is 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride.
What is the SMILES notation for 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride?
The canonical SMILES for 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride is O=C1OC[C@@H](CC2(S(=O)(=O)Cl)CC2)O1.
What is the InChIKey of 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride?
The InChIKey is DZKIEPNRXHDSBC-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H9ClO5S/c8-14(10,11)7(1-2-7)3-5-4-12-6(9)13-5/h5H,1-4H2/t5-/m1/s1.
What are the key properties of 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride?
1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride has a molecular weight of 240.66 g/mol, XLogP of 1.01, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(4R)-2-oxo-1,3-dioxolan-4-yl]methyl]cyclopropane-1-sulfonyl chloride is sourced from PubChem (CID 147458194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).