C12H20N2 — CID 14746073
4-N,4-N-diethyl-2,6-dimethylbenzene-1,4-diamine (PubChem CID 14746073) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 4-N,4-N-diethyl-2,6-dimethylbenzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-2,6-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 14746073 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4-N,4-N-diethyl-2,6-dimethylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/C12H20N2/c1-5-14(6-2)11-7-9(3)12(13)10(4)8-11/h7-8H,5-6,13H2,1-4H3 |
| InChIKey | YTEPJDDAQWIJEP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|