About (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol
(5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol (PubChem CID 147461741) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol.
Molecular Properties
| Compound Name | (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol |
| PubChem CID | 147461741 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol |
| SMILES | CCNC(O)c1nnc(C(C)(C)C)o1 |
| InChI | InChI=1S/C9H17N3O2/c1-5-10-6(13)7-11-12-8(14-7)9(2,3)4/h6,10,13H,5H2,1-4H3 |
| InChIKey | FABGQOLUHHPPJD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol?
The IUPAC name of (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol (CID 147461741) is (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol.
What is the SMILES notation for (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol?
The canonical SMILES for (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol is CCNC(O)c1nnc(C(C)(C)C)o1.
What is the InChIKey of (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol?
The InChIKey is FABGQOLUHHPPJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2/c1-5-10-6(13)7-11-12-8(14-7)9(2,3)4/h6,10,13H,5H2,1-4H3.
What are the key properties of (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol?
(5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol has a molecular weight of 199.25 g/mol, XLogP of 0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-tert-butyl-1,3,4-oxadiazol-2-yl)-(ethylamino)methanol is sourced from PubChem (CID 147461741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).