C23H42ClN7 — CID 14746198
6-chloro-2-N,4-N-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 14746198) has the molecular formula C23H42ClN7 and a molecular weight of 452.09 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 14746198 |
| Molecular Formula | C23H42ClN7 |
| Molecular Weight | 452.09 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | 6-chloro-2-N,4-N-dimethyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CN(c1nc(Cl)nc(N(C)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H42ClN7/c1-20(2)11-15(12-21(3,4)28-20)30(9)18-25-17(24)26-19(27-18)31(10)16-13-22(5,6)29-23(7,8)14-16/h15-16,28-29H,11-14H2,1-10H3 |
| InChIKey | WHCHHPSHMFXYDJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.09 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |