C31H60N8O — CID 14746199
2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 14746199) has the molecular formula C31H60N8O and a molecular weight of 560.88 g/mol. Its IUPAC name is 2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 14746199 |
| Molecular Formula | C31H60N8O |
| Molecular Weight | 560.88 g/mol |
| Exact Mass | 560.49 |
| IUPAC Name | 2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CCCCN(c1nc(NCCO)nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C31H60N8O/c1-11-13-16-38(23-19-28(3,4)36-29(5,6)20-23)26-33-25(32-15-18-40)34-27(35-26)39(17-14-12-2)24-21-30(7,8)37-31(9,10)22-24/h23-24,36-37,40H,11-22H2,1-10H3,(H,32,33,34,35) |
| InChIKey | NTALXEBGSKTAEH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.88 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |