C27H51N7O2 — CID 14746200
2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethanol (PubChem CID 14746200) has the molecular formula C27H51N7O2 and a molecular weight of 505.75 g/mol. Its IUPAC name is 2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethanol.
| Compound Name | 2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethanol |
|---|---|
| PubChem CID | 14746200 |
| Molecular Formula | C27H51N7O2 |
| Molecular Weight | 505.75 g/mol |
| Exact Mass | 505.41 |
| IUPAC Name | 2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethanol |
| SMILES | CCN(c1nc(OCCO)nc(N(CC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C27H51N7O2/c1-11-33(19-15-24(3,4)31-25(5,6)16-19)21-28-22(30-23(29-21)36-14-13-35)34(12-2)20-17-26(7,8)32-27(9,10)18-20/h19-20,31-32,35H,11-18H2,1-10H3 |
| InChIKey | VUBXSLLRIQJUJP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |