C31H59N7O2 — CID 14746201
2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethanol (PubChem CID 14746201) has the molecular formula C31H59N7O2 and a molecular weight of 561.86 g/mol. Its IUPAC name is 2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethanol.
| Compound Name | 2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethanol |
|---|---|
| PubChem CID | 14746201 |
| Molecular Formula | C31H59N7O2 |
| Molecular Weight | 561.86 g/mol |
| Exact Mass | 561.47 |
| IUPAC Name | 2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethanol |
| SMILES | CCCCN(c1nc(OCCO)nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C31H59N7O2/c1-11-13-15-37(23-19-28(3,4)35-29(5,6)20-23)25-32-26(34-27(33-25)40-18-17-39)38(16-14-12-2)24-21-30(7,8)36-31(9,10)22-24/h23-24,35-36,39H,11-22H2,1-10H3 |
| InChIKey | UFPIXSYLDUMFMX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.86 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |