C32H62N8O — CID 14746202
3-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]propan-1-ol (PubChem CID 14746202) has the molecular formula C32H62N8O and a molecular weight of 574.90 g/mol. Its IUPAC name is 3-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 14746202 |
| Molecular Formula | C32H62N8O |
| Molecular Weight | 574.90 g/mol |
| Exact Mass | 574.50 |
| IUPAC Name | 3-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]propan-1-ol |
| SMILES | CCCCN(c1nc(NCCCO)nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C32H62N8O/c1-11-13-17-39(24-20-29(3,4)37-30(5,6)21-24)27-34-26(33-16-15-19-41)35-28(36-27)40(18-14-12-2)25-22-31(7,8)38-32(9,10)23-25/h24-25,37-38,41H,11-23H2,1-10H3,(H,33,34,35,36) |
| InChIKey | IBJAKMWWBWMXMR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.90 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|