C25H48N8O — CID 14746205
2-[[4,6-bis[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 14746205) has the molecular formula C25H48N8O and a molecular weight of 476.71 g/mol. Its IUPAC name is 2-[[4,6-bis[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4,6-bis[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 14746205 |
| Molecular Formula | C25H48N8O |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.40 |
| IUPAC Name | 2-[[4,6-bis[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CN(c1nc(NCCO)nc(N(C)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C25H48N8O/c1-22(2)13-17(14-23(3,4)30-22)32(9)20-27-19(26-11-12-34)28-21(29-20)33(10)18-15-24(5,6)31-25(7,8)16-18/h17-18,30-31,34H,11-16H2,1-10H3,(H,26,27,28,29) |
| InChIKey | GEWJINPOVSEEJC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |