About N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide
N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide (PubChem CID 147464764) has the molecular formula C20H26N4O
and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide |
| PubChem CID | 147464764 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide |
| SMILES | [H]/N=C(/C1=C(N)CC(C)(C)CC1)c1cc2ccc(N(C)C(C)=O)cc2[nH]1 |
| InChI | InChI=1S/C20H26N4O/c1-12(25)24(4)14-6-5-13-9-18(23-17(13)10-14)19(22)15-7-8-20(2,3)11-16(15)21/h5-6,9-10,22-23H,7-8,11,21H2,1-4H3/b22-19- |
| InChIKey | FAPOYQXIBRBNJW-QOCHGBHMSA-N |
| XLogP | 3.94 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide?
The IUPAC name of N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide (CID 147464764) is N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide.
What is the SMILES notation for N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide?
The canonical SMILES for N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide is [H]/N=C(/C1=C(N)CC(C)(C)CC1)c1cc2ccc(N(C)C(C)=O)cc2[nH]1.
What is the InChIKey of N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide?
The InChIKey is FAPOYQXIBRBNJW-QOCHGBHMSA-N. The full InChI is InChI=1S/C20H26N4O/c1-12(25)24(4)14-6-5-13-9-18(23-17(13)10-14)19(22)15-7-8-20(2,3)11-16(15)21/h5-6,9-10,22-23H,7-8,11,21H2,1-4H3/b22-19-.
What are the key properties of N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide?
N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide has a molecular weight of 338.46 g/mol, XLogP of 3.94, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)-1H-indol-6-yl]-N-methylacetamide is sourced from PubChem (CID 147464764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).