About (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate
(5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate (PubChem CID 1474654) has the molecular formula C16H18O3
and a molecular weight of 258.32 g/mol. Its IUPAC name is (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate.
Molecular Properties
| Compound Name | (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate |
| PubChem CID | 1474654 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC2=CC(=O)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H18O3/c1-11-4-6-12(7-5-11)15(18)19-14-8-13(17)9-16(2,3)10-14/h4-8H,9-10H2,1-3H3 |
| InChIKey | WULVYUZAMHODCN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate?
The IUPAC name of (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate (CID 1474654) is (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate.
What is the SMILES notation for (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate?
The canonical SMILES for (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate is Cc1ccc(C(=O)OC2=CC(=O)CC(C)(C)C2)cc1.
What is the InChIKey of (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate?
The InChIKey is WULVYUZAMHODCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O3/c1-11-4-6-12(7-5-11)15(18)19-14-8-13(17)9-16(2,3)10-14/h4-8H,9-10H2,1-3H3.
What are the key properties of (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate?
(5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate has a molecular weight of 258.32 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dimethyl-3-oxocyclohexen-1-yl) 4-methylbenzoate is sourced from PubChem (CID 1474654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).