About 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene
3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene (PubChem CID 147466637) has the molecular formula C8H7F3IN
and a molecular weight of 301.05 g/mol. Its IUPAC name is 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene.
Molecular Properties
| Compound Name | 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene |
| PubChem CID | 147466637 |
| Molecular Formula | C8H7F3IN |
| Molecular Weight | 301.05 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene |
| SMILES | FC(F)(F)C1=CI=CC(C2CC2)=N1 |
| InChI | InChI=1S/C8H7F3IN/c9-8(10,11)7-4-12-3-6(13-7)5-1-2-5/h3-5H,1-2H2 |
| InChIKey | FAYJBXLNSPSIJR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.05 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene?
The IUPAC name of 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene (CID 147466637) is 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene.
What is the SMILES notation for 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene?
The canonical SMILES for 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene is FC(F)(F)C1=CI=CC(C2CC2)=N1.
What is the InChIKey of 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene?
The InChIKey is FAYJBXLNSPSIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3IN/c9-8(10,11)7-4-12-3-6(13-7)5-1-2-5/h3-5H,1-2H2.
What are the key properties of 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene?
3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene has a molecular weight of 301.05 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene is sourced from PubChem (CID 147466637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).