About bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane
bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane (PubChem CID 14746835) has the molecular formula C6H16BNO4
and a molecular weight of 177.01 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane.
Molecular Properties
| Compound Name | bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane |
| PubChem CID | 14746835 |
| Molecular Formula | C6H16BNO4 |
| Molecular Weight | 177.01 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane |
| SMILES | C[N+](C)(CCO)CCO.O=B[O-] |
| InChI | InChI=1S/C6H16NO2.BO2/c1-7(2,3-5-8)4-6-9;2-1-3/h8-9H,3-6H2,1-2H3;/q+1;-1 |
| InChIKey | LRVJJRGZQOOPEJ-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.01 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane?
The IUPAC name of bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane (CID 14746835) is bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane.
What is the SMILES notation for bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane?
The canonical SMILES for bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane is C[N+](C)(CCO)CCO.O=B[O-].
What is the InChIKey of bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane?
The InChIKey is LRVJJRGZQOOPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16NO2.BO2/c1-7(2,3-5-8)4-6-9;2-1-3/h8-9H,3-6H2,1-2H3;/q+1;-1.
What are the key properties of bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane?
bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane has a molecular weight of 177.01 g/mol, XLogP of -2.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethyl)-dimethylazanium;oxido(oxo)borane is sourced from PubChem (CID 14746835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).