About hydrogen phosphate;bis(tetramethylazanium)
hydrogen phosphate;bis(tetramethylazanium) (PubChem CID 14746851) has the molecular formula C8H25N2O4P
and a molecular weight of 244.27 g/mol. Its IUPAC name is hydrogen phosphate;bis(tetramethylazanium).
Molecular Properties
| Compound Name | hydrogen phosphate;bis(tetramethylazanium) |
| PubChem CID | 14746851 |
| Molecular Formula | C8H25N2O4P |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | hydrogen phosphate;bis(tetramethylazanium) |
| SMILES | C[N+](C)(C)C.C[N+](C)(C)C.O=P([O-])([O-])O |
| InChI | InChI=1S/2C4H12N.H3O4P/c3*1-5(2,3)4/h2*1-4H3;(H3,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | NRWCULBPDGBRQD-UHFFFAOYSA-L |
| XLogP | -1.55 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hydrogen phosphate;bis(tetramethylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen phosphate;bis(tetramethylazanium)?
The IUPAC name of hydrogen phosphate;bis(tetramethylazanium) (CID 14746851) is hydrogen phosphate;bis(tetramethylazanium).
What is the SMILES notation for hydrogen phosphate;bis(tetramethylazanium)?
The canonical SMILES for hydrogen phosphate;bis(tetramethylazanium) is C[N+](C)(C)C.C[N+](C)(C)C.O=P([O-])([O-])O.
What is the InChIKey of hydrogen phosphate;bis(tetramethylazanium)?
The InChIKey is NRWCULBPDGBRQD-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H12N.H3O4P/c3*1-5(2,3)4/h2*1-4H3;(H3,1,2,3,4)/q2*+1;/p-2.
What are the key properties of hydrogen phosphate;bis(tetramethylazanium)?
hydrogen phosphate;bis(tetramethylazanium) has a molecular weight of 244.27 g/mol, XLogP of -1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen phosphate;bis(tetramethylazanium) is sourced from PubChem (CID 14746851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).