C26H27F3N4O2S — CID 147469196
4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]-1,1,1-trifluoro-2-methylbut-3-yn-2-ol (PubChem CID 147469196) has the molecular formula C26H27F3N4O2S and a molecular weight of 516.59 g/mol. Its IUPAC name is 4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]-1,1,1-trifluoro-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]-1,1,1-trifluoro-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 147469196 |
| Molecular Formula | C26H27F3N4O2S |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 4-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]-1,1,1-trifluoro-2-methylbut-3-yn-2-ol |
| SMILES | CN1CCC(c2ncc(-c3cnc(N)c(OCc4cccc(C#CC(C)(O)C(F)(F)F)c4)c3)s2)CC1 |
| InChI | InChI=1S/C26H27F3N4O2S/c1-25(34,26(27,28)29)9-6-17-4-3-5-18(12-17)16-35-21-13-20(14-31-23(21)30)22-15-32-24(36-22)19-7-10-33(2)11-8-19/h3-5,12-15,19,34H,7-8,10-11,16H2,1-2H3,(H2,30,31) |
| InChIKey | FBKTYJWUNKTNSS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|