C9H5BrF3NO2S — CID 1474717
N-[(4R,5R)-5-bromo-6-oxo-4,5-dihydrocyclopenta[b]thiophen-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 1474717) has the molecular formula C9H5BrF3NO2S and a molecular weight of 328.11 g/mol. Its IUPAC name is N-[(4R,5R)-5-bromo-6-oxo-4,5-dihydrocyclopenta[b]thiophen-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(4R,5R)-5-bromo-6-oxo-4,5-dihydrocyclopenta[b]thiophen-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 1474717 |
| Molecular Formula | C9H5BrF3NO2S |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 326.92 |
| IUPAC Name | N-[(4R,5R)-5-bromo-6-oxo-4,5-dihydrocyclopenta[b]thiophen-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1c2sccc2[C@@H](NC(=O)C(F)(F)F)[C@H]1Br |
| InChI | InChI=1S/C9H5BrF3NO2S/c10-4-5(14-8(16)9(11,12)13)3-1-2-17-7(3)6(4)15/h1-2,4-5H,(H,14,16)/t4-,5-/m1/s1 |
| InChIKey | JORNURPRWBYZSD-RFZPGFLSSA-N |
| XLogP | 2.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|