About ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate
ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate (PubChem CID 1474731) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate |
| PubChem CID | 1474731 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc(C)cc(C)c2C#N)CC1 |
| InChI | InChI=1S/C16H21N3O2/c1-4-21-16(20)13-5-7-19(8-6-13)15-14(10-17)11(2)9-12(3)18-15/h9,13H,4-8H2,1-3H3 |
| InChIKey | CFPZRPVUKOXUQZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate (CID 1474731) is ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate is CCOC(=O)C1CCN(c2nc(C)cc(C)c2C#N)CC1.
What is the InChIKey of ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate?
The InChIKey is CFPZRPVUKOXUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-4-21-16(20)13-5-7-19(8-6-13)15-14(10-17)11(2)9-12(3)18-15/h9,13H,4-8H2,1-3H3.
What are the key properties of ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate?
ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate has a molecular weight of 287.36 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(3-cyano-4,6-dimethyl-2-pyridinyl)piperidine-4-carboxylate is sourced from PubChem (CID 1474731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).