C17H18IN2- — CID 147473448
2-(5-cyclobuta-2,3-dien-1-yl-2,3,3-trimethylindol-4-yl)iodanuidylethanimine (PubChem CID 147473448) has the molecular formula C17H18IN2- and a molecular weight of 377.25 g/mol. Its IUPAC name is 2-(5-cyclobuta-2,3-dien-1-yl-2,3,3-trimethylindol-4-yl)iodanuidylethanimine.
| Compound Name | 2-(5-cyclobuta-2,3-dien-1-yl-2,3,3-trimethylindol-4-yl)iodanuidylethanimine |
|---|---|
| PubChem CID | 147473448 |
| Molecular Formula | C17H18IN2- |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-(5-cyclobuta-2,3-dien-1-yl-2,3,3-trimethylindol-4-yl)iodanuidylethanimine |
| SMILES | [H]/N=C/C[I-]c1c(C2C=C=C2)ccc2c1C(C)(C)C(C)=N2 |
| InChI | InChI=1S/C17H18IN2/c1-11-17(2,3)15-14(20-11)8-7-13(12-5-4-6-12)16(15)18-9-10-19/h5-8,10,12,19H,9H2,1-3H3/q-1/b19-10+ |
| InChIKey | VCENZDXVVYPMKU-VXLYETTFSA-N |
| XLogP | 0.79 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|