C8H10ClFN3O2+ — CID 147473672
[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-methylpropanoyl]oxidanium (PubChem CID 147473672) has the molecular formula C8H10ClFN3O2+ and a molecular weight of 234.64 g/mol. Its IUPAC name is [2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-methylpropanoyl]oxidanium.
| Compound Name | [2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-methylpropanoyl]oxidanium |
|---|---|
| PubChem CID | 147473672 |
| Molecular Formula | C8H10ClFN3O2+ |
| Molecular Weight | 234.64 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | [2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-2-methylpropanoyl]oxidanium |
| SMILES | CC(C)(Nc1nc(Cl)ncc1F)C(=O)[OH2+] |
| InChI | InChI=1S/C8H9ClFN3O2/c1-8(2,6(14)15)13-5-4(10)3-11-7(9)12-5/h3H,1-2H3,(H,14,15)(H,11,12,13)/p+1 |
| InChIKey | FCGQROGWKLYQHY-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 77.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.64 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|