C20H18 — CID 14747501
1-(5,6,7,8-tetrahydronaphthalen-2-yl)naphthalene (PubChem CID 14747501) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-2-yl)naphthalene.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-2-yl)naphthalene |
|---|---|
| PubChem CID | 14747501 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-2-yl)naphthalene |
| SMILES | c1ccc2c(-c3ccc4c(c3)CCCC4)cccc2c1 |
| InChI | InChI=1S/C20H18/c1-2-8-17-14-18(13-12-15(17)6-1)20-11-5-9-16-7-3-4-10-19(16)20/h3-5,7,9-14H,1-2,6,8H2 |
| InChIKey | FHNKVQJLEQOUBF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |