C35H35F7N2O6 — CID 147476234
[(3S,6R)-6-[2-[2-[(3S,4S)-4-(3,5-difluorophenyl)-4-(4-fluorophenyl)-3-(methoxycarbonylamino)-2-oxobutyl]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate (PubChem CID 147476234) has the molecular formula C35H35F7N2O6 and a molecular weight of 712.66 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[2-[(3S,4S)-4-(3,5-difluorophenyl)-4-(4-fluorophenyl)-3-(methoxycarbonylamino)-2-oxobutyl]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate.
| Compound Name | [(3S,6R)-6-[2-[2-[(3S,4S)-4-(3,5-difluorophenyl)-4-(4-fluorophenyl)-3-(methoxycarbonylamino)-2-oxobutyl]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 147476234 |
| Molecular Formula | C35H35F7N2O6 |
| Molecular Weight | 712.66 g/mol |
| Exact Mass | 712.24 |
| IUPAC Name | [(3S,6R)-6-[2-[2-[(3S,4S)-4-(3,5-difluorophenyl)-4-(4-fluorophenyl)-3-(methoxycarbonylamino)-2-oxobutyl]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate |
| SMILES | COC(=O)N[C@H](C(=O)Cc1cccc(F)c1CC[C@@H]1CN[C@H](COC(=O)CCC(F)(F)F)CO1)[C@@H](c1ccc(F)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C35H35F7N2O6/c1-48-34(47)44-33(32(20-5-7-23(36)8-6-20)22-13-24(37)16-25(38)14-22)30(45)15-21-3-2-4-29(39)28(21)10-9-27-17-43-26(18-49-27)19-50-31(46)11-12-35(40,41)42/h2-8,13-14,16,26-27,32-33,43H,9-12,15,17-19H2,1H3,(H,44,47)/t26-,27+,32-,33+/m0/s1 |
| InChIKey | FCTAFYZSKWEGML-UAEGVTNASA-N |
| XLogP | 6.09 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |