C17H11F4N3O — CID 147476578
(4-fluorophenyl)-(3,5,6-trifluoro-1,4,10-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-8-yl)methanone (PubChem CID 147476578) has the molecular formula C17H11F4N3O and a molecular weight of 349.29 g/mol. Its IUPAC name is (4-fluorophenyl)-(3,5,6-trifluoro-1,4,10-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-8-yl)methanone.
| Compound Name | (4-fluorophenyl)-(3,5,6-trifluoro-1,4,10-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-8-yl)methanone |
|---|---|
| PubChem CID | 147476578 |
| Molecular Formula | C17H11F4N3O |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | (4-fluorophenyl)-(3,5,6-trifluoro-1,4,10-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-8-yl)methanone |
| SMILES | O=C(c1ccc(F)cc1)c1c2n(c3c(F)nc(F)c(F)c13)CCCN2 |
| InChI | InChI=1S/C17H11F4N3O/c18-9-4-2-8(3-5-9)14(25)11-10-12(19)15(20)23-16(21)13(10)24-7-1-6-22-17(11)24/h2-5,22H,1,6-7H2 |
| InChIKey | FCUOOCHOEQRLMK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|