About 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine
2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine (PubChem CID 147477748) has the molecular formula C9H14FN3O
and a molecular weight of 199.23 g/mol. Its IUPAC name is 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine |
| PubChem CID | 147477748 |
| Molecular Formula | C9H14FN3O |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine |
| SMILES | Cc1noc(C2CCC(N)C(F)C2)n1 |
| InChI | InChI=1S/C9H14FN3O/c1-5-12-9(14-13-5)6-2-3-8(11)7(10)4-6/h6-8H,2-4,11H2,1H3 |
| InChIKey | FDAAYAAGSVLKQZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine?
The IUPAC name of 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine (CID 147477748) is 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine.
What is the SMILES notation for 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine?
The canonical SMILES for 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine is Cc1noc(C2CCC(N)C(F)C2)n1.
What is the InChIKey of 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine?
The InChIKey is FDAAYAAGSVLKQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN3O/c1-5-12-9(14-13-5)6-2-3-8(11)7(10)4-6/h6-8H,2-4,11H2,1H3.
What are the key properties of 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine?
2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine has a molecular weight of 199.23 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(3-methyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine is sourced from PubChem (CID 147477748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).