C14H26N2O — CID 147479982
(3S,4R)-N-tert-butyl-1,3-dimethyl-4-prop-2-enylpyrrolidine-3-carboxamide (PubChem CID 147479982) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is (3S,4R)-N-tert-butyl-1,3-dimethyl-4-prop-2-enylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-N-tert-butyl-1,3-dimethyl-4-prop-2-enylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 147479982 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (3S,4R)-N-tert-butyl-1,3-dimethyl-4-prop-2-enylpyrrolidine-3-carboxamide |
| SMILES | C=CC[C@H]1CN(C)C[C@@]1(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H26N2O/c1-7-8-11-9-16(6)10-14(11,5)12(17)15-13(2,3)4/h7,11H,1,8-10H2,2-6H3,(H,15,17)/t11-,14+/m0/s1 |
| InChIKey | FDLDYOWYTFZIBT-SMDDNHRTSA-N |
| XLogP | 2.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|