About (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene
(5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene (PubChem CID 147481647) has the molecular formula C7H8
and a molecular weight of 92.14 g/mol. Its IUPAC name is (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene.
Molecular Properties
| Compound Name | (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene |
| PubChem CID | 147481647 |
| Molecular Formula | C7H8 |
| Molecular Weight | 92.14 g/mol |
| Exact Mass | 92.06 |
| IUPAC Name | (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene |
| SMILES | C1=C2C[C@H]1C1CC21 |
| InChI | InChI=1S/C7H8/c1-4-2-5(1)7-3-6(4)7/h1,4,6-7H,2-3H2/t4-,6?,7?/m0/s1 |
| InChIKey | FDTMYGREFTVQHB-ISGODVSSSA-N |
| XLogP | 1.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.14 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene?
The IUPAC name of (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene (CID 147481647) is (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene.
What is the SMILES notation for (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene?
The canonical SMILES for (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene is C1=C2C[C@H]1C1CC21.
What is the InChIKey of (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene?
The InChIKey is FDTMYGREFTVQHB-ISGODVSSSA-N. The full InChI is InChI=1S/C7H8/c1-4-2-5(1)7-3-6(4)7/h1,4,6-7H,2-3H2/t4-,6?,7?/m0/s1.
What are the key properties of (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene?
(5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene has a molecular weight of 92.14 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-tricyclo[3.1.1.02,4]hept-1(6)-ene is sourced from PubChem (CID 147481647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).