About [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea
[[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea (PubChem CID 1474841) has the molecular formula C9H15N5S2
and a molecular weight of 257.39 g/mol. Its IUPAC name is [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea.
Molecular Properties
| Compound Name | [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea |
| PubChem CID | 1474841 |
| Molecular Formula | C9H15N5S2 |
| Molecular Weight | 257.39 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea |
| SMILES | CCN(CC)c1ncc(C=NNC(N)=S)s1 |
| InChI | InChI=1S/C9H15N5S2/c1-3-14(4-2)9-11-5-7(16-9)6-12-13-8(10)15/h5-6H,3-4H2,1-2H3,(H3,10,13,15) |
| InChIKey | ZODRUMRGJGDMQH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea?
The IUPAC name of [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea (CID 1474841) is [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea.
What is the SMILES notation for [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea?
The canonical SMILES for [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea is CCN(CC)c1ncc(C=NNC(N)=S)s1.
What is the InChIKey of [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea?
The InChIKey is ZODRUMRGJGDMQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5S2/c1-3-14(4-2)9-11-5-7(16-9)6-12-13-8(10)15/h5-6H,3-4H2,1-2H3,(H3,10,13,15).
What are the key properties of [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea?
[[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea has a molecular weight of 257.39 g/mol, XLogP of 1.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]thiourea is sourced from PubChem (CID 1474841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).