C13H14N4OS — CID 1474845
2-[[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-5-yl]methylidene]propanedinitrile (PubChem CID 1474845) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 2-[[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-5-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-5-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 1474845 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-[[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-1,3-thiazol-5-yl]methylidene]propanedinitrile |
| SMILES | C[C@H]1CN(c2ncc(C=C(C#N)C#N)s2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H14N4OS/c1-9-7-17(8-10(2)18-9)13-16-6-12(19-13)3-11(4-14)5-15/h3,6,9-10H,7-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | ABQQEGYUXQPGPF-UWVGGRQHSA-N |
| XLogP | 2.19 |
| TPSA | 72.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|