About N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine
N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine (PubChem CID 1474852) has the molecular formula C16H14BrN3O2
and a molecular weight of 360.21 g/mol. Its IUPAC name is N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine |
| PubChem CID | 1474852 |
| Molecular Formula | C16H14BrN3O2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(Br)cc3)c2cc1OC |
| InChI | InChI=1S/C16H14BrN3O2/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-10(17)4-6-11/h3-9H,1-2H3,(H,18,19,20) |
| InChIKey | MCNVTWIIWNZMGB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine?
The IUPAC name of N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine (CID 1474852) is N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine.
What is the SMILES notation for N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine?
The canonical SMILES for N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine is COc1cc2ncnc(Nc3ccc(Br)cc3)c2cc1OC.
What is the InChIKey of N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine?
The InChIKey is MCNVTWIIWNZMGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrN3O2/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-10(17)4-6-11/h3-9H,1-2H3,(H,18,19,20).
What are the key properties of N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine?
N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine has a molecular weight of 360.21 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-6,7-dimethoxyquinazolin-4-amine is sourced from PubChem (CID 1474852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).