C20H23NS — CID 14748731
10-methyl-6-(4-methylsulfanylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline (PubChem CID 14748731) has the molecular formula C20H23NS and a molecular weight of 309.48 g/mol. Its IUPAC name is 10-methyl-6-(4-methylsulfanylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline.
| Compound Name | 10-methyl-6-(4-methylsulfanylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 14748731 |
| Molecular Formula | C20H23NS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 10-methyl-6-(4-methylsulfanylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
| SMILES | CSc1ccc(C2CN3CCCC3c3c(C)cccc32)cc1 |
| InChI | InChI=1S/C20H23NS/c1-14-5-3-6-17-18(15-8-10-16(22-2)11-9-15)13-21-12-4-7-19(21)20(14)17/h3,5-6,8-11,18-19H,4,7,12-13H2,1-2H3 |
| InChIKey | XXJIJVCRQQOZNH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |