About N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine
N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine (PubChem CID 147487511) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine |
| PubChem CID | 147487511 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine |
| SMILES | CNC[C@H]1C[C@@H](C)CN1 |
| InChI | InChI=1S/C7H16N2/c1-6-3-7(5-8-2)9-4-6/h6-9H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | FEWHVBXCYORMPQ-RNFRBKRXSA-N |
| XLogP | 0.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine?
The IUPAC name of N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine (CID 147487511) is N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine.
What is the SMILES notation for N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine?
The canonical SMILES for N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine is CNC[C@H]1C[C@@H](C)CN1.
What is the InChIKey of N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine?
The InChIKey is FEWHVBXCYORMPQ-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H16N2/c1-6-3-7(5-8-2)9-4-6/h6-9H,3-5H2,1-2H3/t6-,7-/m1/s1.
What are the key properties of N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine?
N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine has a molecular weight of 128.22 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(2R,4R)-4-methylpyrrolidin-2-yl]methanamine is sourced from PubChem (CID 147487511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).