C31H28F7NO2 — CID 147488365
[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(1,2,3,4-tetrahydronaphthalen-2-yl)methanone (PubChem CID 147488365) has the molecular formula C31H28F7NO2 and a molecular weight of 579.56 g/mol. Its IUPAC name is [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(1,2,3,4-tetrahydronaphthalen-2-yl)methanone.
| Compound Name | [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(1,2,3,4-tetrahydronaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 147488365 |
| Molecular Formula | C31H28F7NO2 |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | [(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-(1,2,3,4-tetrahydronaphthalen-2-yl)methanone |
| SMILES | C[C@]1(c2ccc(F)cc2)CN(C(=O)C2CCc3ccccc3C2)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H28F7NO2/c1-28(23-12-14-25(32)15-13-23)18-39(27(40)22-7-6-19-4-2-3-5-21(19)16-22)17-26(28)20-8-10-24(11-9-20)29(41,30(33,34)35)31(36,37)38/h2-5,8-15,22,26,41H,6-7,16-18H2,1H3/t22?,26-,28+/m0/s1 |
| InChIKey | FFAGJXWGRYREAM-SDKBWILHSA-N |
| XLogP | 6.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |