C8H8F3N3O2S — CID 147490244
N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-thiazole-2-carboxamide (PubChem CID 147490244) has the molecular formula C8H8F3N3O2S and a molecular weight of 267.23 g/mol. Its IUPAC name is N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 147490244 |
| Molecular Formula | C8H8F3N3O2S |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NCCNC(=O)C(F)(F)F)c1nccs1 |
| InChI | InChI=1S/C8H8F3N3O2S/c9-8(10,11)7(16)14-2-1-12-5(15)6-13-3-4-17-6/h3-4H,1-2H2,(H,12,15)(H,14,16) |
| InChIKey | FFJIMMDITXSWCX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|