C13H10Br2ClN3O2 — CID 1474913
4,5-dibromo-2-[2-(4-chlorophenyl)-2-methoxyiminoethyl]pyridazin-3-one (PubChem CID 1474913) has the molecular formula C13H10Br2ClN3O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 4,5-dibromo-2-[2-(4-chlorophenyl)-2-methoxyiminoethyl]pyridazin-3-one.
| Compound Name | 4,5-dibromo-2-[2-(4-chlorophenyl)-2-methoxyiminoethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 1474913 |
| Molecular Formula | C13H10Br2ClN3O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 432.88 |
| IUPAC Name | 4,5-dibromo-2-[2-(4-chlorophenyl)-2-methoxyiminoethyl]pyridazin-3-one |
| SMILES | CON=C(Cn1ncc(Br)c(Br)c1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10Br2ClN3O2/c1-21-18-11(8-2-4-9(16)5-3-8)7-19-13(20)12(15)10(14)6-17-19/h2-6H,7H2,1H3 |
| InChIKey | SLDOWLPBQYXOLQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|