About N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine
N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine (PubChem CID 147491542) has the molecular formula C7H15NOS2
and a molecular weight of 193.34 g/mol. Its IUPAC name is N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine.
Molecular Properties
| Compound Name | N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine |
| PubChem CID | 147491542 |
| Molecular Formula | C7H15NOS2 |
| Molecular Weight | 193.34 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine |
| SMILES | COCN=C(CSC)CSC |
| InChI | InChI=1S/C7H15NOS2/c1-9-6-8-7(4-10-2)5-11-3/h4-6H2,1-3H3 |
| InChIKey | FFPSHJDUEJQPBN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine?
The IUPAC name of N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine (CID 147491542) is N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine.
What is the SMILES notation for N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine?
The canonical SMILES for N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine is COCN=C(CSC)CSC.
What is the InChIKey of N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine?
The InChIKey is FFPSHJDUEJQPBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NOS2/c1-9-6-8-7(4-10-2)5-11-3/h4-6H2,1-3H3.
What are the key properties of N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine?
N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine has a molecular weight of 193.34 g/mol, XLogP of 1.76, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(methoxymethyl)-1,3-bis(methylsulfanyl)propan-2-imine is sourced from PubChem (CID 147491542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).