C24H26F3N5O4 — CID 147494534
N-[[4-[1,3-diamino-2-carbamoyl-3-(oxan-4-ylimino)prop-1-enyl]-2,3-difluorophenyl]methyl]-5-fluoro-2-methoxybenzamide (PubChem CID 147494534) has the molecular formula C24H26F3N5O4 and a molecular weight of 505.50 g/mol. Its IUPAC name is N-[[4-[1,3-diamino-2-carbamoyl-3-(oxan-4-ylimino)prop-1-enyl]-2,3-difluorophenyl]methyl]-5-fluoro-2-methoxybenzamide.
| Compound Name | N-[[4-[1,3-diamino-2-carbamoyl-3-(oxan-4-ylimino)prop-1-enyl]-2,3-difluorophenyl]methyl]-5-fluoro-2-methoxybenzamide |
|---|---|
| PubChem CID | 147494534 |
| Molecular Formula | C24H26F3N5O4 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | N-[[4-[1,3-diamino-2-carbamoyl-3-(oxan-4-ylimino)prop-1-enyl]-2,3-difluorophenyl]methyl]-5-fluoro-2-methoxybenzamide |
| SMILES | COc1ccc(F)cc1C(=O)NCc1ccc(C(N)=C(C(N)=O)/C(N)=N/C2CCOCC2)c(F)c1F |
| InChI | InChI=1S/C24H26F3N5O4/c1-35-17-5-3-13(25)10-16(17)24(34)31-11-12-2-4-15(20(27)19(12)26)21(28)18(23(30)33)22(29)32-14-6-8-36-9-7-14/h2-5,10,14H,6-9,11,28H2,1H3,(H2,29,32)(H2,30,33)(H,31,34) |
| InChIKey | BAGWEQZDXYAUIV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 155.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|