C20H20IN3O5S — CID 147495811
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(iodomethyl)-4-[(3-methylthiophene-2-carbonyl)amino]-1,2-oxazole-3-carboxamide (PubChem CID 147495811) has the molecular formula C20H20IN3O5S and a molecular weight of 541.37 g/mol. Its IUPAC name is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(iodomethyl)-4-[(3-methylthiophene-2-carbonyl)amino]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(iodomethyl)-4-[(3-methylthiophene-2-carbonyl)amino]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 147495811 |
| Molecular Formula | C20H20IN3O5S |
| Molecular Weight | 541.37 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(iodomethyl)-4-[(3-methylthiophene-2-carbonyl)amino]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1c(C(=O)NCI)noc1-c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C20H20IN3O5S/c1-9(2)11-6-12(14(26)7-13(11)25)17-15(16(24-29-17)19(27)22-8-21)23-20(28)18-10(3)4-5-30-18/h4-7,9,25-26H,8H2,1-3H3,(H,22,27)(H,23,28) |
| InChIKey | FGKRJQICTYCLJY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|