About 5-chloro-1,3-dimethylpyrazole-4-carbonitrile
5-chloro-1,3-dimethylpyrazole-4-carbonitrile (PubChem CID 1474983) has the molecular formula C6H6ClN3
and a molecular weight of 155.59 g/mol. Its IUPAC name is 5-chloro-1,3-dimethylpyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-chloro-1,3-dimethylpyrazole-4-carbonitrile |
| PubChem CID | 1474983 |
| Molecular Formula | C6H6ClN3 |
| Molecular Weight | 155.59 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 5-chloro-1,3-dimethylpyrazole-4-carbonitrile |
| SMILES | Cc1nn(C)c(Cl)c1C#N |
| InChI | InChI=1S/C6H6ClN3/c1-4-5(3-8)6(7)10(2)9-4/h1-2H3 |
| InChIKey | BVSBKLHMMUZYKA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.59 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-1,3-dimethylpyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-dimethylpyrazole-4-carbonitrile?
The IUPAC name of 5-chloro-1,3-dimethylpyrazole-4-carbonitrile (CID 1474983) is 5-chloro-1,3-dimethylpyrazole-4-carbonitrile.
What is the SMILES notation for 5-chloro-1,3-dimethylpyrazole-4-carbonitrile?
The canonical SMILES for 5-chloro-1,3-dimethylpyrazole-4-carbonitrile is Cc1nn(C)c(Cl)c1C#N.
What is the InChIKey of 5-chloro-1,3-dimethylpyrazole-4-carbonitrile?
The InChIKey is BVSBKLHMMUZYKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN3/c1-4-5(3-8)6(7)10(2)9-4/h1-2H3.
What are the key properties of 5-chloro-1,3-dimethylpyrazole-4-carbonitrile?
5-chloro-1,3-dimethylpyrazole-4-carbonitrile has a molecular weight of 155.59 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-dimethylpyrazole-4-carbonitrile is sourced from PubChem (CID 1474983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).