About 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide
2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide (PubChem CID 14750091) has the molecular formula C16H16FNO
and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide |
| PubChem CID | 14750091 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C(N)=O)c(-c2ccc(F)c(C)c2)c1 |
| InChI | InChI=1S/C16H16FNO/c1-9-6-11(3)15(16(18)19)13(7-9)12-4-5-14(17)10(2)8-12/h4-8H,1-3H3,(H2,18,19) |
| InChIKey | QRLVOFWNWLUFFC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide?
The IUPAC name of 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide (CID 14750091) is 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide.
What is the SMILES notation for 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide?
The canonical SMILES for 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide is Cc1cc(C)c(C(N)=O)c(-c2ccc(F)c(C)c2)c1.
What is the InChIKey of 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide?
The InChIKey is QRLVOFWNWLUFFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FNO/c1-9-6-11(3)15(16(18)19)13(7-9)12-4-5-14(17)10(2)8-12/h4-8H,1-3H3,(H2,18,19).
What are the key properties of 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide?
2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide has a molecular weight of 257.31 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-3-methylphenyl)-4,6-dimethylbenzamide is sourced from PubChem (CID 14750091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).