C20H24N4 — CID 147503003
(5S)-5,7-dimethyl-4-(2-methylphenyl)spiro[1,4,7,9-tetrazatricyclo[6.3.0.02,6]undeca-2(6),8,10-triene-3,1'-cyclopentane] (PubChem CID 147503003) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is (5S)-5,7-dimethyl-4-(2-methylphenyl)spiro[1,4,7,9-tetrazatricyclo[6.3.0.02,6]undeca-2(6),8,10-triene-3,1'-cyclopentane].
| Compound Name | (5S)-5,7-dimethyl-4-(2-methylphenyl)spiro[1,4,7,9-tetrazatricyclo[6.3.0.02,6]undeca-2(6),8,10-triene-3,1'-cyclopentane] |
|---|---|
| PubChem CID | 147503003 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (5S)-5,7-dimethyl-4-(2-methylphenyl)spiro[1,4,7,9-tetrazatricyclo[6.3.0.02,6]undeca-2(6),8,10-triene-3,1'-cyclopentane] |
| SMILES | Cc1ccccc1N1[C@@H](C)c2c(n3ccnc3n2C)C12CCCC2 |
| InChI | InChI=1S/C20H24N4/c1-14-8-4-5-9-16(14)24-15(2)17-18(20(24)10-6-7-11-20)23-13-12-21-19(23)22(17)3/h4-5,8-9,12-13,15H,6-7,10-11H2,1-3H3/t15-/m0/s1 |
| InChIKey | FHUCFXUFABBNOS-HNNXBMFYSA-N |
| XLogP | 4.33 |
| TPSA | 25.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |