C23H29ClN5O9P — CID 147503661
[2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-dihydroxypropan-2-yl]phosphonic acid (PubChem CID 147503661) has the molecular formula C23H29ClN5O9P and a molecular weight of 585.94 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-dihydroxypropan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-dihydroxypropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 147503661 |
| Molecular Formula | C23H29ClN5O9P |
| Molecular Weight | 585.94 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-dihydroxypropan-2-yl]phosphonic acid |
| SMILES | O=P(O)(O)C(CO)(CO)OC[C@H]1O[C@@H](n2ncc3c(N[C@@H]4CCCc5ccccc54)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H29ClN5O9P/c24-22-27-19(26-15-7-3-5-12-4-1-2-6-13(12)15)14-8-25-29(20(14)28-22)21-18(33)17(32)16(38-21)9-37-23(10-30,11-31)39(34,35)36/h1-2,4,6,8,15-18,21,30-33H,3,5,7,9-11H2,(H,26,27,28)(H2,34,35,36)/t15-,16-,17-,18-,21-/m1/s1 |
| InChIKey | FHXLRABZWOPAOP-PDOZGGDVSA-N |
| XLogP | 0.46 |
| TPSA | 212.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.94 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|