C6H11NPt — CID 147503785
(2-methanidylcyclopentyl)azanide;platinum(2+) (PubChem CID 147503785) has the molecular formula C6H11NPt and a molecular weight of 292.24 g/mol. Its IUPAC name is (2-methanidylcyclopentyl)azanide;platinum(2+).
| Compound Name | (2-methanidylcyclopentyl)azanide;platinum(2+) |
|---|---|
| PubChem CID | 147503785 |
| Molecular Formula | C6H11NPt |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | (2-methanidylcyclopentyl)azanide;platinum(2+) |
| SMILES | [CH2-]C1CCCC1[NH-].[Pt+2] |
| InChI | InChI=1S/C6H11N.Pt/c1-5-3-2-4-6(5)7;/h5-7H,1-4H2;/q-2;+2 |
| InChIKey | FHYBTMLECLBAOI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|