About 1-benzyl-3,5-dibromo-1,2,4-triazole
1-benzyl-3,5-dibromo-1,2,4-triazole (PubChem CID 1475046) has the molecular formula C9H7Br2N3
and a molecular weight of 316.98 g/mol. Its IUPAC name is 1-benzyl-3,5-dibromo-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-benzyl-3,5-dibromo-1,2,4-triazole |
| PubChem CID | 1475046 |
| Molecular Formula | C9H7Br2N3 |
| Molecular Weight | 316.98 g/mol |
| Exact Mass | 314.90 |
| IUPAC Name | 1-benzyl-3,5-dibromo-1,2,4-triazole |
| SMILES | Brc1nc(Br)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C9H7Br2N3/c10-8-12-9(11)14(13-8)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | YXSNCHAOAYRKCF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.98 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-3,5-dibromo-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3,5-dibromo-1,2,4-triazole?
The IUPAC name of 1-benzyl-3,5-dibromo-1,2,4-triazole (CID 1475046) is 1-benzyl-3,5-dibromo-1,2,4-triazole.
What is the SMILES notation for 1-benzyl-3,5-dibromo-1,2,4-triazole?
The canonical SMILES for 1-benzyl-3,5-dibromo-1,2,4-triazole is Brc1nc(Br)n(Cc2ccccc2)n1.
What is the InChIKey of 1-benzyl-3,5-dibromo-1,2,4-triazole?
The InChIKey is YXSNCHAOAYRKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Br2N3/c10-8-12-9(11)14(13-8)6-7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of 1-benzyl-3,5-dibromo-1,2,4-triazole?
1-benzyl-3,5-dibromo-1,2,4-triazole has a molecular weight of 316.98 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3,5-dibromo-1,2,4-triazole is sourced from PubChem (CID 1475046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).