About [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate
[(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 14750607) has the molecular formula C13H17N3O5
and a molecular weight of 295.30 g/mol. Its IUPAC name is [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| PubChem CID | 14750607 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)Nc1ccn([C@H]2CC[C@@H](COC(C)=O)O2)c(=O)n1 |
| InChI | InChI=1S/C13H17N3O5/c1-8(17)14-11-5-6-16(13(19)15-11)12-4-3-10(21-12)7-20-9(2)18/h5-6,10,12H,3-4,7H2,1-2H3,(H,14,15,17,19)/t10-,12+/m0/s1 |
| InChIKey | LBFZYGWAPSEWPD-CMPLNLGQSA-N |
| XLogP | 0.44 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate?
The IUPAC name of [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (CID 14750607) is [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
What is the SMILES notation for [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate?
The canonical SMILES for [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate is CC(=O)Nc1ccn([C@H]2CC[C@@H](COC(C)=O)O2)c(=O)n1.
What is the InChIKey of [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate?
The InChIKey is LBFZYGWAPSEWPD-CMPLNLGQSA-N. The full InChI is InChI=1S/C13H17N3O5/c1-8(17)14-11-5-6-16(13(19)15-11)12-4-3-10(21-12)7-20-9(2)18/h5-6,10,12H,3-4,7H2,1-2H3,(H,14,15,17,19)/t10-,12+/m0/s1.
What are the key properties of [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate?
[(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate has a molecular weight of 295.30 g/mol, XLogP of 0.44, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-5-(4-acetamido-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl acetate is sourced from PubChem (CID 14750607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).