About benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide
benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide (PubChem CID 14750662) has the molecular formula C18H21IN2O3
and a molecular weight of 440.28 g/mol. Its IUPAC name is benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide.
Molecular Properties
| Compound Name | benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide |
| PubChem CID | 14750662 |
| Molecular Formula | C18H21IN2O3 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide |
| SMILES | C[n+]1cccc(C(=O)NCCCC(=O)OCc2ccccc2)c1.[I-] |
| InChI | InChI=1S/C18H20N2O3.HI/c1-20-12-6-9-16(13-20)18(22)19-11-5-10-17(21)23-14-15-7-3-2-4-8-15;/h2-4,6-9,12-13H,5,10-11,14H2,1H3;1H |
| InChIKey | FANGFONSDBUWBV-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide?
The IUPAC name of benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide (CID 14750662) is benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide.
What is the SMILES notation for benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide?
The canonical SMILES for benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide is C[n+]1cccc(C(=O)NCCCC(=O)OCc2ccccc2)c1.[I-].
What is the InChIKey of benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide?
The InChIKey is FANGFONSDBUWBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3.HI/c1-20-12-6-9-16(13-20)18(22)19-11-5-10-17(21)23-14-15-7-3-2-4-8-15;/h2-4,6-9,12-13H,5,10-11,14H2,1H3;1H.
What are the key properties of benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide?
benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide has a molecular weight of 440.28 g/mol, XLogP of -1.23, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide is sourced from PubChem (CID 14750662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).