C25H36BrF2NO3S — CID 147506842
N-[(1R,3'R,5'S)-6-bromo-4'-(difluoromethoxy)-1-(1-ethoxyethenyl)-3',5'-dimethylspiro[3H-indene-2,1'-cyclohexane]-1-yl]-2-methylpropane-2-sulfinamide (PubChem CID 147506842) has the molecular formula C25H36BrF2NO3S and a molecular weight of 548.53 g/mol. Its IUPAC name is N-[(1R,3'R,5'S)-6-bromo-4'-(difluoromethoxy)-1-(1-ethoxyethenyl)-3',5'-dimethylspiro[3H-indene-2,1'-cyclohexane]-1-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1R,3'R,5'S)-6-bromo-4'-(difluoromethoxy)-1-(1-ethoxyethenyl)-3',5'-dimethylspiro[3H-indene-2,1'-cyclohexane]-1-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 147506842 |
| Molecular Formula | C25H36BrF2NO3S |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | N-[(1R,3'R,5'S)-6-bromo-4'-(difluoromethoxy)-1-(1-ethoxyethenyl)-3',5'-dimethylspiro[3H-indene-2,1'-cyclohexane]-1-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C(OCC)[C@]1(NS(=O)C(C)(C)C)c2cc(Br)ccc2CC12C[C@@H](C)C(OC(F)F)[C@@H](C)C2 |
| InChI | InChI=1S/C25H36BrF2NO3S/c1-8-31-17(4)25(29-33(30)23(5,6)7)20-11-19(26)10-9-18(20)14-24(25)12-15(2)21(16(3)13-24)32-22(27)28/h9-11,15-16,21-22,29H,4,8,12-14H2,1-3,5-7H3/t15-,16+,21?,24?,25-,33?/m0/s1 |
| InChIKey | FIMRBYVBZSYFTC-XPMKYHTOSA-N |
| XLogP | 6.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|